shell0409 shell0409

02-02-2017
Mathematics

contestada

The solutions to the inequality y < −x + 2 are shaded on the graph. Which point is a solution?

Respuesta :

ode0snow ode0snow

02-02-2017

The answer would be 0,0 because the dotted line is a negative slope to the right, intersecting the y axis at 2 and the shading is below.

Answer Link

Otras preguntas

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

what city is the state capital of Utah?

Write a detailed note on Manufacturing Process types and Service process types in process design?

Explain why aluminium resists corrosion but iron does not.Explain the term culling as used in livestock management.thr(a)(ii)State two methods of preventing iro

In about one hundred words, explain why you think Achebe chose to tell the story of the clashes between colonialism and African culture from an African point of

Why are G proteins found in cell membrane of the cell ?

Calculate the surface area of a cube when the length of a side a = 15cm.Surface area = 6a^2

Purple Panda Products Inc. is considering a project that will require $650,000 in assets. The project will be financed with 100% equity. The company faces a tax

Mrs. Yadav purchase 25 kg of vegetable at Rs 20 per kg and sold at a loss of Rs 50 find her Selling rate and loss percent

Please answer this question now